C23H30 — CID 123231380
3-(5,5-dimethylhexa-1,3-dien-2-yl)-4,5,7,7-tetramethylbenzo[7]annulene (PubChem CID 123231380) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is 3-(5,5-dimethylhexa-1,3-dien-2-yl)-4,5,7,7-tetramethylbenzo[7]annulene.
| Compound Name | 3-(5,5-dimethylhexa-1,3-dien-2-yl)-4,5,7,7-tetramethylbenzo[7]annulene |
|---|---|
| PubChem CID | 123231380 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 3-(5,5-dimethylhexa-1,3-dien-2-yl)-4,5,7,7-tetramethylbenzo[7]annulene |
| SMILES | C=C(C=CC(C)(C)C)c1ccc2c(c1C)C(C)=CC(C)(C)C=C2 |
| InChI | InChI=1S/C23H30/c1-16(11-13-22(4,5)6)20-10-9-19-12-14-23(7,8)15-17(2)21(19)18(20)3/h9-15H,1H2,2-8H3 |
| InChIKey | CEGGACHLEMCZCZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|