C10H10F6N2O2 — CID 123237567
4-ethyl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine (PubChem CID 123237567) has the molecular formula C10H10F6N2O2 and a molecular weight of 304.19 g/mol. Its IUPAC name is 4-ethyl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine.
| Compound Name | 4-ethyl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
|---|---|
| PubChem CID | 123237567 |
| Molecular Formula | C10H10F6N2O2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-ethyl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
| SMILES | CCc1cc(OCC(F)(F)F)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H10F6N2O2/c1-2-6-3-7(19-4-9(11,12)13)18-8(17-6)20-5-10(14,15)16/h3H,2,4-5H2,1H3 |
| InChIKey | ZRSMVCREQFFCMD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |