C9H15N — CID 123251903
(5Z)-N,3-dimethylhepta-2,5-dien-4-imine (PubChem CID 123251903) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (5Z)-N,3-dimethylhepta-2,5-dien-4-imine.
| Compound Name | (5Z)-N,3-dimethylhepta-2,5-dien-4-imine |
|---|---|
| PubChem CID | 123251903 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (5Z)-N,3-dimethylhepta-2,5-dien-4-imine |
| SMILES | CC=C(C)C(/C=C\C)=N\C |
| InChI | InChI=1S/C9H15N/c1-5-7-9(10-4)8(3)6-2/h5-7H,1-4H3/b7-5-,8-6?,10-9- |
| InChIKey | HGRLVFSUWOLNDY-FPSYPHLVSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|