C8H11Br3 — CID 123251913
2-bromo-3,4-bis(bromomethyl)hexa-2,4-diene (PubChem CID 123251913) has the molecular formula C8H11Br3 and a molecular weight of 346.89 g/mol. Its IUPAC name is 2-bromo-3,4-bis(bromomethyl)hexa-2,4-diene.
| Compound Name | 2-bromo-3,4-bis(bromomethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 123251913 |
| Molecular Formula | C8H11Br3 |
| Molecular Weight | 346.89 g/mol |
| Exact Mass | 343.84 |
| IUPAC Name | 2-bromo-3,4-bis(bromomethyl)hexa-2,4-diene |
| SMILES | CC=C(CBr)C(CBr)=C(C)Br |
| InChI | InChI=1S/C8H11Br3/c1-3-7(4-9)8(5-10)6(2)11/h3H,4-5H2,1-2H3 |
| InChIKey | KWSJLXSXLOAHKG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|