C25H25N3 — CID 123263622
N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-1-(3-pyridin-4-ylphenyl)ethanimine (PubChem CID 123263622) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-1-(3-pyridin-4-ylphenyl)ethanimine.
| Compound Name | N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-1-(3-pyridin-4-ylphenyl)ethanimine |
|---|---|
| PubChem CID | 123263622 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-1-(3-pyridin-4-ylphenyl)ethanimine |
| SMILES | CCc1ccc2[nH]cc(CC/N=C(\C)c3cccc(-c4ccncc4)c3)c2c1 |
| InChI | InChI=1S/C25H25N3/c1-3-19-7-8-25-24(15-19)23(17-28-25)11-14-27-18(2)21-5-4-6-22(16-21)20-9-12-26-13-10-20/h4-10,12-13,15-17,28H,3,11,14H2,1-2H3/b27-18+ |
| InChIKey | JTNFWUITRCVVGP-OVVQPSECSA-N |
| XLogP | 5.84 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|