C27H25N3 — CID 123972225
3-[3-[N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]phenyl]benzonitrile (PubChem CID 123972225) has the molecular formula C27H25N3 and a molecular weight of 391.52 g/mol. Its IUPAC name is 3-[3-[N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]phenyl]benzonitrile.
| Compound Name | 3-[3-[N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 123972225 |
| Molecular Formula | C27H25N3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-[3-[N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]phenyl]benzonitrile |
| SMILES | CCc1ccc2[nH]cc(CC/N=C(\C)c3cccc(-c4cccc(C#N)c4)c3)c2c1 |
| InChI | InChI=1S/C27H25N3/c1-3-20-10-11-27-26(15-20)25(18-30-27)12-13-29-19(2)22-7-5-9-24(16-22)23-8-4-6-21(14-23)17-28/h4-11,14-16,18,30H,3,12-13H2,1-2H3/b29-19+ |
| InChIKey | ZUZQHVVPEZSBGU-VUTHCHCSSA-N |
| XLogP | 6.32 |
| TPSA | 51.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|