C26H25FN2 — CID 123794883
N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-1-[3-(2-fluorophenyl)phenyl]ethanimine (PubChem CID 123794883) has the molecular formula C26H25FN2 and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-1-[3-(2-fluorophenyl)phenyl]ethanimine.
| Compound Name | N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-1-[3-(2-fluorophenyl)phenyl]ethanimine |
|---|---|
| PubChem CID | 123794883 |
| Molecular Formula | C26H25FN2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[2-(5-ethyl-1H-indol-3-yl)ethyl]-1-[3-(2-fluorophenyl)phenyl]ethanimine |
| SMILES | CCc1ccc2[nH]cc(CC/N=C(\C)c3cccc(-c4ccccc4F)c3)c2c1 |
| InChI | InChI=1S/C26H25FN2/c1-3-19-11-12-26-24(15-19)22(17-29-26)13-14-28-18(2)20-7-6-8-21(16-20)23-9-4-5-10-25(23)27/h4-12,15-17,29H,3,13-14H2,1-2H3/b28-18+ |
| InChIKey | ZRXXMCYCJNYURA-MTDXEUNCSA-N |
| XLogP | 6.59 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|