C16H15F2N — CID 145492710
N-[2-(3,4-difluorophenyl)ethyl]-1-phenylethanimine (PubChem CID 145492710) has the molecular formula C16H15F2N and a molecular weight of 259.30 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)ethyl]-1-phenylethanimine.
| Compound Name | N-[2-(3,4-difluorophenyl)ethyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 145492710 |
| Molecular Formula | C16H15F2N |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)ethyl]-1-phenylethanimine |
| SMILES | C/C(=N\CCc1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C16H15F2N/c1-12(14-5-3-2-4-6-14)19-10-9-13-7-8-15(17)16(18)11-13/h2-8,11H,9-10H2,1H3/b19-12+ |
| InChIKey | MANGHJXTMPGDAJ-XDHOZWIPSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|