C31H31NO — CID 123366328
5-ethyl-3-[2-[3-[1-[3-[(4-methoxyphenyl)methyl]phenyl]ethenyl]cyclopropen-1-yl]ethyl]-1H-indole (PubChem CID 123366328) has the molecular formula C31H31NO and a molecular weight of 433.60 g/mol. Its IUPAC name is 5-ethyl-3-[2-[3-[1-[3-[(4-methoxyphenyl)methyl]phenyl]ethenyl]cyclopropen-1-yl]ethyl]-1H-indole.
| Compound Name | 5-ethyl-3-[2-[3-[1-[3-[(4-methoxyphenyl)methyl]phenyl]ethenyl]cyclopropen-1-yl]ethyl]-1H-indole |
|---|---|
| PubChem CID | 123366328 |
| Molecular Formula | C31H31NO |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 5-ethyl-3-[2-[3-[1-[3-[(4-methoxyphenyl)methyl]phenyl]ethenyl]cyclopropen-1-yl]ethyl]-1H-indole |
| SMILES | C=C(c1cccc(Cc2ccc(OC)cc2)c1)C1C=C1CCc1c[nH]c2ccc(CC)cc12 |
| InChI | InChI=1S/C31H31NO/c1-4-22-10-15-31-30(18-22)27(20-32-31)12-11-26-19-29(26)21(2)25-7-5-6-24(17-25)16-23-8-13-28(33-3)14-9-23/h5-10,13-15,17-20,29,32H,2,4,11-12,16H2,1,3H3 |
| InChIKey | NGLWHORQXQACAI-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|