C22H46FN2+ — CID 123263783
but-2-en-2-yl-fluoro-methyl-[5,5,6,7-tetramethyl-4-[(propan-2-ylamino)methyl]nonyl]azanium (PubChem CID 123263783) has the molecular formula C22H46FN2+ and a molecular weight of 357.62 g/mol. Its IUPAC name is but-2-en-2-yl-fluoro-methyl-[5,5,6,7-tetramethyl-4-[(propan-2-ylamino)methyl]nonyl]azanium.
| Compound Name | but-2-en-2-yl-fluoro-methyl-[5,5,6,7-tetramethyl-4-[(propan-2-ylamino)methyl]nonyl]azanium |
|---|---|
| PubChem CID | 123263783 |
| Molecular Formula | C22H46FN2+ |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 357.36 |
| IUPAC Name | but-2-en-2-yl-fluoro-methyl-[5,5,6,7-tetramethyl-4-[(propan-2-ylamino)methyl]nonyl]azanium |
| SMILES | CC=C(C)[N+](C)(F)CCCC(CNC(C)C)C(C)(C)C(C)C(C)CC |
| InChI | InChI=1S/C22H46FN2/c1-11-18(5)20(7)22(8,9)21(16-24-17(3)4)14-13-15-25(10,23)19(6)12-2/h12,17-18,20-21,24H,11,13-16H2,1-10H3/q+1 |
| InChIKey | RVZNQHYJKLOULJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|