C27H30N6O4 — CID 123264621
prop-2-enyl 2-[[(Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyanoprop-2-enoyl]amino]-2-methylpropanoate (PubChem CID 123264621) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is prop-2-enyl 2-[[(Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyanoprop-2-enoyl]amino]-2-methylpropanoate.
| Compound Name | prop-2-enyl 2-[[(Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyanoprop-2-enoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 123264621 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | prop-2-enyl 2-[[(Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyanoprop-2-enoyl]amino]-2-methylpropanoate |
| SMILES | [C-]#[N+]/C(=C\c1c(-c2ccc(C)cc2)c2c(N)ncnc2n1CCCO)C(=O)NC(C)(C)C(=O)OCC=C |
| InChI | InChI=1S/C27H30N6O4/c1-6-14-37-26(36)27(3,4)32-25(35)19(29-5)15-20-21(18-10-8-17(2)9-11-18)22-23(28)30-16-31-24(22)33(20)12-7-13-34/h6,8-11,15-16,34H,1,7,12-14H2,2-4H3,(H,32,35)(H2,28,30,31)/b19-15- |
| InChIKey | MQTJCROACXCNOT-CYVLTUHYSA-N |
| XLogP | 3.26 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|