C10H13N — CID 123274452
3,4-dimethyl-N-prop-2-ynylpenta-2,4-dien-1-imine (PubChem CID 123274452) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 3,4-dimethyl-N-prop-2-ynylpenta-2,4-dien-1-imine.
| Compound Name | 3,4-dimethyl-N-prop-2-ynylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123274452 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3,4-dimethyl-N-prop-2-ynylpenta-2,4-dien-1-imine |
| SMILES | C#CC/N=C/C=C(C)C(=C)C |
| InChI | InChI=1S/C10H13N/c1-5-7-11-8-6-10(4)9(2)3/h1,6,8H,2,7H2,3-4H3/b10-6?,11-8+ |
| InChIKey | QNGCNGHPNPIABD-VJJUCBOQSA-N |
| XLogP | 2.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|