C9H15ClS — CID 123285248
2-chloro-3-ethyl-5-propan-2-yl-2,3-dihydrothiophene (PubChem CID 123285248) has the molecular formula C9H15ClS and a molecular weight of 190.74 g/mol. Its IUPAC name is 2-chloro-3-ethyl-5-propan-2-yl-2,3-dihydrothiophene.
| Compound Name | 2-chloro-3-ethyl-5-propan-2-yl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 123285248 |
| Molecular Formula | C9H15ClS |
| Molecular Weight | 190.74 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-chloro-3-ethyl-5-propan-2-yl-2,3-dihydrothiophene |
| SMILES | CCC1C=C(C(C)C)SC1Cl |
| InChI | InChI=1S/C9H15ClS/c1-4-7-5-8(6(2)3)11-9(7)10/h5-7,9H,4H2,1-3H3 |
| InChIKey | TWZWWIWYLQRPGL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|