C8H13ClS — CID 123978444
2-chloro-3,5-diethyl-2,3-dihydrothiophene (PubChem CID 123978444) has the molecular formula C8H13ClS and a molecular weight of 176.71 g/mol. Its IUPAC name is 2-chloro-3,5-diethyl-2,3-dihydrothiophene.
| Compound Name | 2-chloro-3,5-diethyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 123978444 |
| Molecular Formula | C8H13ClS |
| Molecular Weight | 176.71 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 2-chloro-3,5-diethyl-2,3-dihydrothiophene |
| SMILES | CCC1=CC(CC)C(Cl)S1 |
| InChI | InChI=1S/C8H13ClS/c1-3-6-5-7(4-2)10-8(6)9/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | AFVSERMUOMLAAJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|