C6H9ClS — CID 146323217
3-chloro-2,5-dimethyl-2,3-dihydrothiophene (PubChem CID 146323217) has the molecular formula C6H9ClS and a molecular weight of 148.66 g/mol. Its IUPAC name is 3-chloro-2,5-dimethyl-2,3-dihydrothiophene.
| Compound Name | 3-chloro-2,5-dimethyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 146323217 |
| Molecular Formula | C6H9ClS |
| Molecular Weight | 148.66 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | 3-chloro-2,5-dimethyl-2,3-dihydrothiophene |
| SMILES | CC1=CC(Cl)C(C)S1 |
| InChI | InChI=1S/C6H9ClS/c1-4-3-6(7)5(2)8-4/h3,5-6H,1-2H3 |
| InChIKey | WRDVKTCCNNBGHX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.66 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|