C15H17ClN4OS — CID 123288315
4-chloro-N-[3-(cyclopentylsulfinylmethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 123288315) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is 4-chloro-N-[3-(cyclopentylsulfinylmethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-[3-(cyclopentylsulfinylmethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123288315 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-chloro-N-[3-(cyclopentylsulfinylmethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | O=S(Cc1cccc(Nc2ncnc(Cl)n2)c1)C1CCCC1 |
| InChI | InChI=1S/C15H17ClN4OS/c16-14-17-10-18-15(20-14)19-12-5-3-4-11(8-12)9-22(21)13-6-1-2-7-13/h3-5,8,10,13H,1-2,6-7,9H2,(H,17,18,19,20) |
| InChIKey | BEXOYRUJGXNIMZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |