C27H40N4O6Si — CID 123307311
tert-butyl N-[4-[4-[2-formyl-4-(methoxycarbonylamino)phenyl]-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]butylidene]carbamate (PubChem CID 123307311) has the molecular formula C27H40N4O6Si and a molecular weight of 544.73 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[2-formyl-4-(methoxycarbonylamino)phenyl]-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]butylidene]carbamate.
| Compound Name | tert-butyl N-[4-[4-[2-formyl-4-(methoxycarbonylamino)phenyl]-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]butylidene]carbamate |
|---|---|
| PubChem CID | 123307311 |
| Molecular Formula | C27H40N4O6Si |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | tert-butyl N-[4-[4-[2-formyl-4-(methoxycarbonylamino)phenyl]-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]butylidene]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2nc(CCCC=NC(=O)OC(C)(C)C)[nH]c2COCC[Si](C)(C)C)c(C=O)c1 |
| InChI | InChI=1S/C27H40N4O6Si/c1-27(2,3)37-25(33)28-13-9-8-10-23-30-22(18-36-14-15-38(5,6)7)24(31-23)21-12-11-20(16-19(21)17-32)29-26(34)35-4/h11-13,16-17H,8-10,14-15,18H2,1-7H3,(H,29,34)(H,30,31) |
| InChIKey | YYZUIGDBMBPLQM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|