C26H39BrN4O5Si — CID 123906782
tert-butyl N-[4-[4-[2-bromo-4-(methoxycarbonylamino)phenyl]-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]butylidene]carbamate (PubChem CID 123906782) has the molecular formula C26H39BrN4O5Si and a molecular weight of 595.61 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[2-bromo-4-(methoxycarbonylamino)phenyl]-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]butylidene]carbamate.
| Compound Name | tert-butyl N-[4-[4-[2-bromo-4-(methoxycarbonylamino)phenyl]-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]butylidene]carbamate |
|---|---|
| PubChem CID | 123906782 |
| Molecular Formula | C26H39BrN4O5Si |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | tert-butyl N-[4-[4-[2-bromo-4-(methoxycarbonylamino)phenyl]-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]butylidene]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2nc(CCCC=NC(=O)OC(C)(C)C)[nH]c2COCC[Si](C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C26H39BrN4O5Si/c1-26(2,3)36-24(32)28-13-9-8-10-22-30-21(17-35-14-15-37(5,6)7)23(31-22)19-12-11-18(16-20(19)27)29-25(33)34-4/h11-13,16H,8-10,14-15,17H2,1-7H3,(H,29,33)(H,30,31) |
| InChIKey | BXPWNUIOOHSTDR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|