C15H19N — CID 123311258
N,3,4-trimethyl-2-methylidene-1-phenylpent-3-en-1-imine (PubChem CID 123311258) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N,3,4-trimethyl-2-methylidene-1-phenylpent-3-en-1-imine.
| Compound Name | N,3,4-trimethyl-2-methylidene-1-phenylpent-3-en-1-imine |
|---|---|
| PubChem CID | 123311258 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N,3,4-trimethyl-2-methylidene-1-phenylpent-3-en-1-imine |
| SMILES | C=C(C(C)=C(C)C)/C(=N\C)c1ccccc1 |
| InChI | InChI=1S/C15H19N/c1-11(2)12(3)13(4)15(16-5)14-9-7-6-8-10-14/h6-10H,4H2,1-3,5H3/b16-15+ |
| InChIKey | IVJJMLMIIISQCS-FOCLMDBBSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|