C12H14BrN — CID 142884235
2-bromo-N,3-dimethyl-1-phenylbut-3-en-1-imine (PubChem CID 142884235) has the molecular formula C12H14BrN and a molecular weight of 252.16 g/mol. Its IUPAC name is 2-bromo-N,3-dimethyl-1-phenylbut-3-en-1-imine.
| Compound Name | 2-bromo-N,3-dimethyl-1-phenylbut-3-en-1-imine |
|---|---|
| PubChem CID | 142884235 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2-bromo-N,3-dimethyl-1-phenylbut-3-en-1-imine |
| SMILES | C=C(C)C(Br)/C(=N\C)c1ccccc1 |
| InChI | InChI=1S/C12H14BrN/c1-9(2)11(13)12(14-3)10-7-5-4-6-8-10/h4-8,11H,1H2,2-3H3/b14-12- |
| InChIKey | MXXWGYZPNBOECL-OWBHPGMISA-N |
| XLogP | 3.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|