C11H20N2Si — CID 123314308
1-[methyl(phenyl)silyl]butane-1,4-diamine (PubChem CID 123314308) has the molecular formula C11H20N2Si and a molecular weight of 208.38 g/mol. Its IUPAC name is 1-[methyl(phenyl)silyl]butane-1,4-diamine.
| Compound Name | 1-[methyl(phenyl)silyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 123314308 |
| Molecular Formula | C11H20N2Si |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-[methyl(phenyl)silyl]butane-1,4-diamine |
| SMILES | C[SiH](c1ccccc1)C(N)CCCN |
| InChI | InChI=1S/C11H20N2Si/c1-14(11(13)8-5-9-12)10-6-3-2-4-7-10/h2-4,6-7,11,14H,5,8-9,12-13H2,1H3 |
| InChIKey | VYQCUJNRACVKLJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|