C16H24ClFN2 — CID 123315115
4-(1-chloro-2-fluorohexa-2,4-dien-3-yl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile (PubChem CID 123315115) has the molecular formula C16H24ClFN2 and a molecular weight of 298.83 g/mol. Its IUPAC name is 4-(1-chloro-2-fluorohexa-2,4-dien-3-yl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile.
| Compound Name | 4-(1-chloro-2-fluorohexa-2,4-dien-3-yl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 123315115 |
| Molecular Formula | C16H24ClFN2 |
| Molecular Weight | 298.83 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 4-(1-chloro-2-fluorohexa-2,4-dien-3-yl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile |
| SMILES | CC=CC(=C(F)CCl)C1CNC(CC(C)(C)C)C1C#N |
| InChI | InChI=1S/C16H24ClFN2/c1-5-6-11(14(18)8-17)13-10-20-15(12(13)9-19)7-16(2,3)4/h5-6,12-13,15,20H,7-8,10H2,1-4H3 |
| InChIKey | DRTZUQUVOZIESO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|