C16H22ClFN2 — CID 143958654
4-(3-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile (PubChem CID 143958654) has the molecular formula C16H22ClFN2 and a molecular weight of 296.82 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile.
| Compound Name | 4-(3-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 143958654 |
| Molecular Formula | C16H22ClFN2 |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-(3-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile |
| SMILES | CC(C)(C)CC1NCC(C2=C(F)C(Cl)CC=C2)C1C#N |
| InChI | InChI=1S/C16H22ClFN2/c1-16(2,3)7-14-11(8-19)12(9-20-14)10-5-4-6-13(17)15(10)18/h4-5,11-14,20H,6-7,9H2,1-3H3 |
| InChIKey | WEPKPVSTCVWQJL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|