C17H22ClFN2 — CID 143958873
4-(3-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-2-(2,2-dimethylbut-3-enyl)pyrrolidine-3-carbonitrile (PubChem CID 143958873) has the molecular formula C17H22ClFN2 and a molecular weight of 308.83 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-2-(2,2-dimethylbut-3-enyl)pyrrolidine-3-carbonitrile.
| Compound Name | 4-(3-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-2-(2,2-dimethylbut-3-enyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 143958873 |
| Molecular Formula | C17H22ClFN2 |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-(3-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-2-(2,2-dimethylbut-3-enyl)pyrrolidine-3-carbonitrile |
| SMILES | C=CC(C)(C)CC1NCC(C2=C(F)C(Cl)CC=C2)C1C#N |
| InChI | InChI=1S/C17H22ClFN2/c1-4-17(2,3)8-15-12(9-20)13(10-21-15)11-6-5-7-14(18)16(11)19/h4-6,12-15,21H,1,7-8,10H2,2-3H3 |
| InChIKey | GPWHSPNBSNCVCJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|