C22H21N5O4 — CID 123318667
[1-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)-3-phenylpropan-2-yl]carbamic acid (PubChem CID 123318667) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is [1-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)-3-phenylpropan-2-yl]carbamic acid.
| Compound Name | [1-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)-3-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 123318667 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [1-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)-3-phenylpropan-2-yl]carbamic acid |
| SMILES | Cc1cc2nc3[nH]c(=O)n(CC(Cc4ccccc4)NC(=O)O)c(=O)c3nc2cc1C |
| InChI | InChI=1S/C22H21N5O4/c1-12-8-16-17(9-13(12)2)25-19-18(24-16)20(28)27(21(29)26-19)11-15(23-22(30)31)10-14-6-4-3-5-7-14/h3-9,15,23H,10-11H2,1-2H3,(H,30,31)(H,25,26,29) |
| InChIKey | YVCOISDKMJOMJU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|