C28H38O4 — CID 123323757
[3,4-bis(4-methylphenoxy)-5-(2,4,4-trimethylhex-5-en-2-yl)oxolan-2-yl]methanol (PubChem CID 123323757) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is [3,4-bis(4-methylphenoxy)-5-(2,4,4-trimethylhex-5-en-2-yl)oxolan-2-yl]methanol.
| Compound Name | [3,4-bis(4-methylphenoxy)-5-(2,4,4-trimethylhex-5-en-2-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 123323757 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | [3,4-bis(4-methylphenoxy)-5-(2,4,4-trimethylhex-5-en-2-yl)oxolan-2-yl]methanol |
| SMILES | C=CC(C)(C)CC(C)(C)C1OC(CO)C(Oc2ccc(C)cc2)C1Oc1ccc(C)cc1 |
| InChI | InChI=1S/C28H38O4/c1-8-27(4,5)18-28(6,7)26-25(31-22-15-11-20(3)12-16-22)24(23(17-29)32-26)30-21-13-9-19(2)10-14-21/h8-16,23-26,29H,1,17-18H2,2-7H3 |
| InChIKey | FEBLESYMBXCUON-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|