C28H36N2O8 — CID 71515876
[(2R,3R,4R,5R)-3,4-bis(4-nitrophenoxy)-5-undec-10-enyloxolan-2-yl]methanol (PubChem CID 71515876) has the molecular formula C28H36N2O8 and a molecular weight of 528.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis(4-nitrophenoxy)-5-undec-10-enyloxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis(4-nitrophenoxy)-5-undec-10-enyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 71515876 |
| Molecular Formula | C28H36N2O8 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis(4-nitrophenoxy)-5-undec-10-enyloxolan-2-yl]methanol |
| SMILES | C=CCCCCCCCCC[C@H]1O[C@H](CO)[C@@H](Oc2ccc([N+](=O)[O-])cc2)[C@@H]1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H36N2O8/c1-2-3-4-5-6-7-8-9-10-11-25-27(36-23-16-12-21(13-17-23)29(32)33)28(26(20-31)38-25)37-24-18-14-22(15-19-24)30(34)35/h2,12-19,25-28,31H,1,3-11,20H2/t25-,26-,27-,28-/m1/s1 |
| InChIKey | OBPXPBJBQLGRLC-BIYDSLDMSA-N |
| XLogP | 6.15 |
| TPSA | 134.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|