C9H17NO2 — CID 123327446
1-(1,2,3,6-tetrahydropyridin-6-yl)butane-1,2-diol (PubChem CID 123327446) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-(1,2,3,6-tetrahydropyridin-6-yl)butane-1,2-diol.
| Compound Name | 1-(1,2,3,6-tetrahydropyridin-6-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 123327446 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1-(1,2,3,6-tetrahydropyridin-6-yl)butane-1,2-diol |
| SMILES | CCC(O)C(O)C1C=CCCN1 |
| InChI | InChI=1S/C9H17NO2/c1-2-8(11)9(12)7-5-3-4-6-10-7/h3,5,7-12H,2,4,6H2,1H3 |
| InChIKey | JCZPRINYJQVKQP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|