C11H14N2O4S — CID 123328010
3-(1-oxopentan-3-yldiazenyl)benzenesulfonic acid (PubChem CID 123328010) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-(1-oxopentan-3-yldiazenyl)benzenesulfonic acid.
| Compound Name | 3-(1-oxopentan-3-yldiazenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 123328010 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-(1-oxopentan-3-yldiazenyl)benzenesulfonic acid |
| SMILES | CCC(CC=O)/N=N/c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H14N2O4S/c1-2-9(6-7-14)12-13-10-4-3-5-11(8-10)18(15,16)17/h3-5,7-9H,2,6H2,1H3,(H,15,16,17)/b13-12+ |
| InChIKey | FAPGWYGBVGDIAG-OUKQBFOZSA-N |
| XLogP | 2.38 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|