C19H34Cl2N2OSi — CID 123329230
N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-3,3-dimethylbutan-2-amine (PubChem CID 123329230) has the molecular formula C19H34Cl2N2OSi and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-3,3-dimethylbutan-2-amine.
| Compound Name | N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 123329230 |
| Molecular Formula | C19H34Cl2N2OSi |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-3,3-dimethylbutan-2-amine |
| SMILES | CC[Si](CC)(CC)OC(CNC(C)C(C)(C)C)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C19H34Cl2N2OSi/c1-8-25(9-2,10-3)24-17(13-23-14(4)19(5,6)7)18-15(20)11-22-12-16(18)21/h11-12,14,17,23H,8-10,13H2,1-7H3 |
| InChIKey | GPEJIOVQXIXQBT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|