C21H33Cl2NOSi — CID 123383749
N-[2-(2,6-dichlorophenyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-3-amine (PubChem CID 123383749) has the molecular formula C21H33Cl2NOSi and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-3-amine.
| Compound Name | N-[2-(2,6-dichlorophenyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-3-amine |
|---|---|
| PubChem CID | 123383749 |
| Molecular Formula | C21H33Cl2NOSi |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[2-(2,6-dichlorophenyl)-2-triethylsilyloxyethyl]spiro[3.3]heptan-3-amine |
| SMILES | CC[Si](CC)(CC)OC(CNC1CCC12CCC2)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H33Cl2NOSi/c1-4-26(5-2,6-3)25-18(20-16(22)9-7-10-17(20)23)15-24-19-11-14-21(19)12-8-13-21/h7,9-10,18-19,24H,4-6,8,11-15H2,1-3H3 |
| InChIKey | PUPOSUILNDLZPO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|