C21H36Cl2N2O2Si — CID 123654554
4-[[[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]amino]methyl]-1-methylcyclohexan-1-ol (PubChem CID 123654554) has the molecular formula C21H36Cl2N2O2Si and a molecular weight of 447.52 g/mol. Its IUPAC name is 4-[[[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]amino]methyl]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]amino]methyl]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 123654554 |
| Molecular Formula | C21H36Cl2N2O2Si |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-[[[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]amino]methyl]-1-methylcyclohexan-1-ol |
| SMILES | CC[Si](CC)(CC)OC(CNCC1CCC(C)(O)CC1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C21H36Cl2N2O2Si/c1-5-28(6-2,7-3)27-19(20-17(22)13-25-14-18(20)23)15-24-12-16-8-10-21(4,26)11-9-16/h13-14,16,19,24,26H,5-12,15H2,1-4H3 |
| InChIKey | MJMQHQGJJOXPTQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|