C19H31Cl2N3OSi — CID 123526328
N-[2-(2,6-dichlorophenyl)-2-triethylsilyloxyethyl]-4-imino-2-methanimidoylbutan-1-amine (PubChem CID 123526328) has the molecular formula C19H31Cl2N3OSi and a molecular weight of 416.47 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenyl)-2-triethylsilyloxyethyl]-4-imino-2-methanimidoylbutan-1-amine.
| Compound Name | N-[2-(2,6-dichlorophenyl)-2-triethylsilyloxyethyl]-4-imino-2-methanimidoylbutan-1-amine |
|---|---|
| PubChem CID | 123526328 |
| Molecular Formula | C19H31Cl2N3OSi |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[2-(2,6-dichlorophenyl)-2-triethylsilyloxyethyl]-4-imino-2-methanimidoylbutan-1-amine |
| SMILES | [H]/N=C/CC(/C=N/[H])CNCC(O[Si](CC)(CC)CC)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H31Cl2N3OSi/c1-4-26(5-2,6-3)25-18(14-24-13-15(12-23)10-11-22)19-16(20)8-7-9-17(19)21/h7-9,11-12,15,18,22-24H,4-6,10,13-14H2,1-3H3/b22-11+,23-12+ |
| InChIKey | MKWHRUCGDAUUCE-LCHFAGMQSA-N |
| XLogP | 5.95 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|