C8H7Cl2N — CID 57206389
2-(2,6-dichlorophenyl)ethanimine (PubChem CID 57206389) has the molecular formula C8H7Cl2N and a molecular weight of 188.06 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)ethanimine.
| Compound Name | 2-(2,6-dichlorophenyl)ethanimine |
|---|---|
| PubChem CID | 57206389 |
| Molecular Formula | C8H7Cl2N |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 2-(2,6-dichlorophenyl)ethanimine |
| SMILES | [H]/N=C/Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H7Cl2N/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3,5,11H,4H2/b11-5+ |
| InChIKey | VTAKMUIPFCLUPZ-VZUCSPMQSA-N |
| XLogP | 3.19 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|