C25H42ClNOSi — CID 123276173
2-(2-chloro-4,6-dimethylphenyl)-N-(spiro[2.5]octan-6-ylmethyl)-2-triethylsilyloxyethanamine (PubChem CID 123276173) has the molecular formula C25H42ClNOSi and a molecular weight of 436.16 g/mol. Its IUPAC name is 2-(2-chloro-4,6-dimethylphenyl)-N-(spiro[2.5]octan-6-ylmethyl)-2-triethylsilyloxyethanamine.
| Compound Name | 2-(2-chloro-4,6-dimethylphenyl)-N-(spiro[2.5]octan-6-ylmethyl)-2-triethylsilyloxyethanamine |
|---|---|
| PubChem CID | 123276173 |
| Molecular Formula | C25H42ClNOSi |
| Molecular Weight | 436.16 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 2-(2-chloro-4,6-dimethylphenyl)-N-(spiro[2.5]octan-6-ylmethyl)-2-triethylsilyloxyethanamine |
| SMILES | CC[Si](CC)(CC)OC(CNCC1CCC2(CC1)CC2)c1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C25H42ClNOSi/c1-6-29(7-2,8-3)28-23(24-20(5)15-19(4)16-22(24)26)18-27-17-21-9-11-25(12-10-21)13-14-25/h15-16,21,23,27H,6-14,17-18H2,1-5H3 |
| InChIKey | DSNBGXOACLGUMV-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.16 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|