C16H27ClOSi — CID 123489978
1-(4-chloro-2,6-dimethylphenyl)ethoxy-triethylsilane (PubChem CID 123489978) has the molecular formula C16H27ClOSi and a molecular weight of 298.93 g/mol. Its IUPAC name is 1-(4-chloro-2,6-dimethylphenyl)ethoxy-triethylsilane.
| Compound Name | 1-(4-chloro-2,6-dimethylphenyl)ethoxy-triethylsilane |
|---|---|
| PubChem CID | 123489978 |
| Molecular Formula | C16H27ClOSi |
| Molecular Weight | 298.93 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(4-chloro-2,6-dimethylphenyl)ethoxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C)c1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C16H27ClOSi/c1-7-19(8-2,9-3)18-14(6)16-12(4)10-15(17)11-13(16)5/h10-11,14H,7-9H2,1-6H3 |
| InChIKey | AJKLLXILSVDNPX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.93 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|