C22H31ClFNOSi — CID 158215374
[1-(3-chloro-5-methyl-4-pyridinyl)-4-(4-fluorophenyl)butoxy]-triethylsilane (PubChem CID 158215374) has the molecular formula C22H31ClFNOSi and a molecular weight of 408.03 g/mol. Its IUPAC name is [1-(3-chloro-5-methyl-4-pyridinyl)-4-(4-fluorophenyl)butoxy]-triethylsilane.
| Compound Name | [1-(3-chloro-5-methyl-4-pyridinyl)-4-(4-fluorophenyl)butoxy]-triethylsilane |
|---|---|
| PubChem CID | 158215374 |
| Molecular Formula | C22H31ClFNOSi |
| Molecular Weight | 408.03 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [1-(3-chloro-5-methyl-4-pyridinyl)-4-(4-fluorophenyl)butoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(CCCc1ccc(F)cc1)c1c(C)cncc1Cl |
| InChI | InChI=1S/C22H31ClFNOSi/c1-5-27(6-2,7-3)26-21(22-17(4)15-25-16-20(22)23)10-8-9-18-11-13-19(24)14-12-18/h11-16,21H,5-10H2,1-4H3 |
| InChIKey | WUTRTBCVSVSYMO-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.03 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|