C15H5F19 — CID 123334559
[1,1,1,2,3,3,4,5,5,6,7,7,7-tridecafluoro-4,6-bis(trifluoromethyl)heptan-2-yl]benzene (PubChem CID 123334559) has the molecular formula C15H5F19 and a molecular weight of 546.17 g/mol. Its IUPAC name is [1,1,1,2,3,3,4,5,5,6,7,7,7-tridecafluoro-4,6-bis(trifluoromethyl)heptan-2-yl]benzene.
| Compound Name | [1,1,1,2,3,3,4,5,5,6,7,7,7-tridecafluoro-4,6-bis(trifluoromethyl)heptan-2-yl]benzene |
|---|---|
| PubChem CID | 123334559 |
| Molecular Formula | C15H5F19 |
| Molecular Weight | 546.17 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | [1,1,1,2,3,3,4,5,5,6,7,7,7-tridecafluoro-4,6-bis(trifluoromethyl)heptan-2-yl]benzene |
| SMILES | FC(F)(F)C(F)(c1ccccc1)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H5F19/c16-7(12(23,24)25,6-4-2-1-3-5-6)10(19,20)8(17,13(26,27)28)11(21,22)9(18,14(29,30)31)15(32,33)34/h1-5H |
| InChIKey | RZIWBWVIDDTREI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.17 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |