C6H8N3+ — CID 123338072
1,1-dimethylpyrazol-1-ium-4-carbonitrile (PubChem CID 123338072) has the molecular formula C6H8N3+ and a molecular weight of 122.15 g/mol. Its IUPAC name is 1,1-dimethylpyrazol-1-ium-4-carbonitrile.
| Compound Name | 1,1-dimethylpyrazol-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 123338072 |
| Molecular Formula | C6H8N3+ |
| Molecular Weight | 122.15 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 1,1-dimethylpyrazol-1-ium-4-carbonitrile |
| SMILES | C[N+]1(C)C=C(C#N)C=N1 |
| InChI | InChI=1S/C6H8N3/c1-9(2)5-6(3-7)4-8-9/h4-5H,1-2H3/q+1 |
| InChIKey | KRFYGISRKDMLQT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|