About 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile
3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile (PubChem CID 123744216) has the molecular formula C9H7N
and a molecular weight of 129.16 g/mol. Its IUPAC name is 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile.
Analyze 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile?
The IUPAC name of 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile (CID 123744216) is 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile.
What is the SMILES notation for 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile?
The canonical SMILES for 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile is CC1=CC=C=CC(C#N)=C1.
What is the InChIKey of 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile?
The InChIKey is RUSFSQWKRGHEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N/c1-8-4-2-3-5-9(6-8)7-10/h2,4-6H,1H3.
What are the key properties of 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile?
3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile has a molecular weight of 129.16 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclohepta-1,3,5,6-tetraene-1-carbonitrile is sourced from PubChem (CID 123744216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).