C14H32NO10PS2 — CID 123349356
1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate (PubChem CID 123349356) has the molecular formula C14H32NO10PS2 and a molecular weight of 469.52 g/mol. Its IUPAC name is 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate.
| Compound Name | 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate |
|---|---|
| PubChem CID | 123349356 |
| Molecular Formula | C14H32NO10PS2 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate |
| SMILES | CCOP(=O)(OCC)OCCC(C)(C)COS(=O)(=O)CCCS(=O)(=O)ONC |
| InChI | InChI=1S/C14H32NO10PS2/c1-6-21-26(16,22-7-2)23-10-9-14(3,4)13-24-27(17,18)11-8-12-28(19,20)25-15-5/h15H,6-13H2,1-5H3 |
| InChIKey | CADQMSWUARUGOJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|