About 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate
1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate (PubChem CID 123349356) has the molecular formula C14H32NO10PS2
and a molecular weight of 469.52 g/mol. Its IUPAC name is 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate.
Molecular Properties
| Compound Name | 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate |
| PubChem CID | 123349356 |
| Molecular Formula | C14H32NO10PS2 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate |
| SMILES | CCOP(=O)(OCC)OCCC(C)(C)COS(=O)(=O)CCCS(=O)(=O)ONC |
| InChI | InChI=1S/C14H32NO10PS2/c1-6-21-26(16,22-7-2)23-10-9-14(3,4)13-24-27(17,18)11-8-12-28(19,20)25-15-5/h15H,6-13H2,1-5H3 |
| InChIKey | CADQMSWUARUGOJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate?
The IUPAC name of 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate (CID 123349356) is 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate.
What is the SMILES notation for 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate?
The canonical SMILES for 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate is CCOP(=O)(OCC)OCCC(C)(C)COS(=O)(=O)CCCS(=O)(=O)ONC.
What is the InChIKey of 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate?
The InChIKey is CADQMSWUARUGOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32NO10PS2/c1-6-21-26(16,22-7-2)23-10-9-14(3,4)13-24-27(17,18)11-8-12-28(19,20)25-15-5/h15H,6-13H2,1-5H3.
What are the key properties of 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate?
1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate has a molecular weight of 469.52 g/mol, XLogP of 1.82, 17 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(4-diethoxyphosphoryloxy-2,2-dimethylbutyl) 3-O-(methylamino) propane-1,3-disulfonate is sourced from PubChem (CID 123349356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).