C28H30O5Si2 — CID 123384714
(3,5-dimethoxyphenyl)-[(3,5-dimethoxyphenyl)-phenylsilyl]oxy-phenylsilane (PubChem CID 123384714) has the molecular formula C28H30O5Si2 and a molecular weight of 502.72 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[(3,5-dimethoxyphenyl)-phenylsilyl]oxy-phenylsilane.
| Compound Name | (3,5-dimethoxyphenyl)-[(3,5-dimethoxyphenyl)-phenylsilyl]oxy-phenylsilane |
|---|---|
| PubChem CID | 123384714 |
| Molecular Formula | C28H30O5Si2 |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[(3,5-dimethoxyphenyl)-phenylsilyl]oxy-phenylsilane |
| SMILES | COc1cc(OC)cc([SiH](O[SiH](c2ccccc2)c2cc(OC)cc(OC)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H30O5Si2/c1-29-21-15-22(30-2)18-27(17-21)34(25-11-7-5-8-12-25)33-35(26-13-9-6-10-14-26)28-19-23(31-3)16-24(20-28)32-4/h5-20,34-35H,1-4H3 |
| InChIKey | SXAVFJFQCICZBP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|