About carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate
carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate (PubChem CID 123388626) has the molecular formula C8H8F3N3O4S
and a molecular weight of 299.23 g/mol. Its IUPAC name is carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate.
Molecular Properties
| Compound Name | carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate |
| PubChem CID | 123388626 |
| Molecular Formula | C8H8F3N3O4S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate |
| SMILES | [H]/N=C(\N)OS(=O)(=O)c1ncccc1OCC(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O4S/c9-8(10,11)4-17-5-2-1-3-14-6(5)19(15,16)18-7(12)13/h1-3H,4H2,(H3,12,13) |
| InChIKey | QYRXBSMJVPHUHL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate?
The IUPAC name of carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate (CID 123388626) is carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate.
What is the SMILES notation for carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate?
The canonical SMILES for carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate is [H]/N=C(\N)OS(=O)(=O)c1ncccc1OCC(F)(F)F.
What is the InChIKey of carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate?
The InChIKey is QYRXBSMJVPHUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3O4S/c9-8(10,11)4-17-5-2-1-3-14-6(5)19(15,16)18-7(12)13/h1-3H,4H2,(H3,12,13).
What are the key properties of carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate?
carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate has a molecular weight of 299.23 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbamimidoyl 3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonate is sourced from PubChem (CID 123388626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).