C21H27Cl2N3O4 — CID 123392006
tert-butyl 4-[[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]amino]-4-isocyanopiperidine-1-carboxylate (PubChem CID 123392006) has the molecular formula C21H27Cl2N3O4 and a molecular weight of 456.37 g/mol. Its IUPAC name is tert-butyl 4-[[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]amino]-4-isocyanopiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]amino]-4-isocyanopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123392006 |
| Molecular Formula | C21H27Cl2N3O4 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | tert-butyl 4-[[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]amino]-4-isocyanopiperidine-1-carboxylate |
| SMILES | [C-]#[N+]C1(NC(=O)C(C)(C)Oc2ccc(Cl)cc2Cl)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H27Cl2N3O4/c1-19(2,3)30-18(28)26-11-9-21(24-6,10-12-26)25-17(27)20(4,5)29-16-8-7-14(22)13-15(16)23/h7-8,13H,9-12H2,1-5H3,(H,25,27) |
| InChIKey | FHGYJTBMLMCFGZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|