C12H15BO3 — CID 123394246
(4-cyclohexa-1,3-dien-1-yloxycyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 123394246) has the molecular formula C12H15BO3 and a molecular weight of 218.06 g/mol. Its IUPAC name is (4-cyclohexa-1,3-dien-1-yloxycyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (4-cyclohexa-1,3-dien-1-yloxycyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 123394246 |
| Molecular Formula | C12H15BO3 |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (4-cyclohexa-1,3-dien-1-yloxycyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | OB(O)C1C=CC(OC2=CC=CCC2)=CC1 |
| InChI | InChI=1S/C12H15BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-2,4,6,8-10,14-15H,3,5,7H2 |
| InChIKey | WLUKLMPTYULUIO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|