C20H22BNO3 — CID 152813571
[4-[cyclohexa-1,3-dien-1-ylmethyl(phenyl)carbamoyl]cyclohexa-2,4-dien-1-yl]boronic acid (PubChem CID 152813571) has the molecular formula C20H22BNO3 and a molecular weight of 335.21 g/mol. Its IUPAC name is [4-[cyclohexa-1,3-dien-1-ylmethyl(phenyl)carbamoyl]cyclohexa-2,4-dien-1-yl]boronic acid.
| Compound Name | [4-[cyclohexa-1,3-dien-1-ylmethyl(phenyl)carbamoyl]cyclohexa-2,4-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 152813571 |
| Molecular Formula | C20H22BNO3 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [4-[cyclohexa-1,3-dien-1-ylmethyl(phenyl)carbamoyl]cyclohexa-2,4-dien-1-yl]boronic acid |
| SMILES | O=C(C1=CCC(B(O)O)C=C1)N(CC1=CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C20H22BNO3/c23-20(17-11-13-18(14-12-17)21(24)25)22(19-9-5-2-6-10-19)15-16-7-3-1-4-8-16/h1-3,5-7,9-13,18,24-25H,4,8,14-15H2 |
| InChIKey | SRVLVNWMIJIOJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|