C9H13BO2 — CID 167506576
(4-cyclopropylcyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 167506576) has the molecular formula C9H13BO2 and a molecular weight of 164.01 g/mol. Its IUPAC name is (4-cyclopropylcyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (4-cyclopropylcyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 167506576 |
| Molecular Formula | C9H13BO2 |
| Molecular Weight | 164.01 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (4-cyclopropylcyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | OB(O)C1C=CC(C2CC2)=CC1 |
| InChI | InChI=1S/C9H13BO2/c11-10(12)9-5-3-8(4-6-9)7-1-2-7/h3-5,7,9,11-12H,1-2,6H2 |
| InChIKey | ZEASTDNOJJEGFM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.01 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|