C11H18N2 — CID 89473883
(1S)-4-piperidin-4-ylcyclohexa-2,4-dien-1-amine (PubChem CID 89473883) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (1S)-4-piperidin-4-ylcyclohexa-2,4-dien-1-amine.
| Compound Name | (1S)-4-piperidin-4-ylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89473883 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (1S)-4-piperidin-4-ylcyclohexa-2,4-dien-1-amine |
| SMILES | N[C@@H]1C=CC(C2CCNCC2)=CC1 |
| InChI | InChI=1S/C11H18N2/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-3,10-11,13H,4-8,12H2/t11-/m1/s1 |
| InChIKey | VDJWQWUZMOOCIX-LLVKDONJSA-N |
| XLogP | 1.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |