C36H34ClN5O2Si — CID 123401732
tert-butyl-[[3-chloro-5-[[12-methyl-4-(1,3-oxazol-2-yl)-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl]phenyl]methoxy]-diphenylsilane (PubChem CID 123401732) has the molecular formula C36H34ClN5O2Si and a molecular weight of 632.24 g/mol. Its IUPAC name is tert-butyl-[[3-chloro-5-[[12-methyl-4-(1,3-oxazol-2-yl)-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl]phenyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[3-chloro-5-[[12-methyl-4-(1,3-oxazol-2-yl)-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl]phenyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 123401732 |
| Molecular Formula | C36H34ClN5O2Si |
| Molecular Weight | 632.24 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | tert-butyl-[[3-chloro-5-[[12-methyl-4-(1,3-oxazol-2-yl)-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl]phenyl]methoxy]-diphenylsilane |
| SMILES | Cc1nnc2ccc3c(cc(-c4ncco4)n3Cc3cc(Cl)cc(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)c3)n12 |
| InChI | InChI=1S/C36H34ClN5O2Si/c1-25-39-40-34-16-15-31-32(42(25)34)22-33(35-38-17-18-43-35)41(31)23-26-19-27(21-28(37)20-26)24-44-45(36(2,3)4,29-11-7-5-8-12-29)30-13-9-6-10-14-30/h5-22H,23-24H2,1-4H3 |
| InChIKey | JJYCFIFCODTNLK-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 70.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.24 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|