C16H36N2Si — CID 123403893
4-ethenylsilyl-1-N,1-N'-diethyl-1-N,1-N'-di(propan-2-yl)butane-1,1-diamine (PubChem CID 123403893) has the molecular formula C16H36N2Si and a molecular weight of 284.56 g/mol. Its IUPAC name is 4-ethenylsilyl-1-N,1-N'-diethyl-1-N,1-N'-di(propan-2-yl)butane-1,1-diamine.
| Compound Name | 4-ethenylsilyl-1-N,1-N'-diethyl-1-N,1-N'-di(propan-2-yl)butane-1,1-diamine |
|---|---|
| PubChem CID | 123403893 |
| Molecular Formula | C16H36N2Si |
| Molecular Weight | 284.56 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | 4-ethenylsilyl-1-N,1-N'-diethyl-1-N,1-N'-di(propan-2-yl)butane-1,1-diamine |
| SMILES | C=C[SiH2]CCCC(N(CC)C(C)C)N(CC)C(C)C |
| InChI | InChI=1S/C16H36N2Si/c1-8-17(14(4)5)16(12-11-13-19-10-3)18(9-2)15(6)7/h10,14-16H,3,8-9,11-13,19H2,1-2,4-7H3 |
| InChIKey | WODNXHSVBMGZPM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|